CAS 1133115-64-6 is the registry number for Methyl 4,7-dichloro-8-methylquinoline-2-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Methyl 4,7-dichloro-8-methylquinoline-2-carboxylate (CAS 1133115-64-6) is a chemical compound with the molecular formula C12H9Cl2NO2 and a molecular weight of 270.11 g/mol. IUPAC name: methyl 4,7-dichloro-8-methylquinoline-2-carboxylate. InChIKey: YCODGLFIKPZDTK-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO2 |
|---|---|
| Molecular weight | 270.11 g/mol |
| IUPAC name | methyl 4,7-dichloro-8-methylquinoline-2-carboxylate |
| InChIKey | YCODGLFIKPZDTK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1N=C(C=C2Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)