CAS 7324-89-2 is the registry number for Ethyl 2-cyano-3-(2,4-dichlorophenyl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl (E)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enoate (CAS 7324-89-2) is a chemical compound with the molecular formula C12H9Cl2NO2 and a molecular weight of 270.11 g/mol. IUPAC name: ethyl (E)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enoate. InChIKey: HDHAZBAICIKTCX-WEVVVXLNSA-N.
| Molecular formula | C12H9Cl2NO2 |
|---|---|
| Molecular weight | 270.11 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enoate |
| InChIKey | HDHAZBAICIKTCX-WEVVVXLNSA-N |
| SMILES | CCOC(=O)/C(=C/C1=C(C=C(C=C1)Cl)Cl)/C#N |
Computed by PubChem (NCBI)