Products 1705612-20-9

CAS 1705612-20-9 is the registry number for Methyl 2,4-dichloro-3-methylquinoline-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 2,4-dichloro-3-methylquinoline-6-carboxylate (CAS 1705612-20-9) is a chemical compound with the molecular formula C12H9Cl2NO2 and a molecular weight of 270.11 g/mol. IUPAC name: methyl 2,4-dichloro-3-methylquinoline-6-carboxylate. InChIKey: MPGAZRQMIRPJCO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9Cl2NO2
Molecular weight270.11 g/mol
IUPAC namemethyl 2,4-dichloro-3-methylquinoline-6-carboxylate
InChIKeyMPGAZRQMIRPJCO-UHFFFAOYSA-N
SMILESCC1=C(C2=C(C=CC(=C2)C(=O)OC)N=C1Cl)Cl

Computed by PubChem (NCBI)