CAS 113332-25-5 appears in our catalog under these names: (4AS)-6,7-dihydroxy-1,1,4a-trimethyl-2,3,4,4a,10,10a-hexahydrophenanthren-9(1H)-one, 98%, (+)-Nimbidiol, Nimbidiol. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 25mg, 10mg, 5mg, 50mg, 1mg.
(4aS,10aS)-6,7-dihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one (CAS 113332-25-5) is a chemical compound with the molecular formula C17H22O3 and a molecular weight of 274.35 g/mol. IUPAC name: (4aS,10aS)-6,7-dihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one. InChIKey: JMBKXUYCBVKSSY-DOTOQJQBSA-N.
| Molecular formula | C17H22O3 |
|---|---|
| Molecular weight | 274.35 g/mol |
| IUPAC name | (4aS,10aS)-6,7-dihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
| InChIKey | JMBKXUYCBVKSSY-DOTOQJQBSA-N |
| SMILES | C[C@]12CCCC([C@@H]1CC(=O)C3=CC(=C(C=C23)O)O)(C)C |
Computed by PubChem (NCBI)