Products 340023-12-3

CAS 340023-12-3 is the registry number for 4-Hydroxymethylbicyclo[2.2.2]octane-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl 4-(hydroxymethyl)bicyclo[2.2.2]octane-1-carboxylate (CAS 340023-12-3) is a chemical compound with the molecular formula C17H22O3 and a molecular weight of 274.35 g/mol. IUPAC name: benzyl 4-(hydroxymethyl)bicyclo[2.2.2]octane-1-carboxylate. InChIKey: GWFIFOXXMPGWJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22O3
Molecular weight274.35 g/mol
IUPAC namebenzyl 4-(hydroxymethyl)bicyclo[2.2.2]octane-1-carboxylate
InChIKeyGWFIFOXXMPGWJZ-UHFFFAOYSA-N
SMILESC1CC2(CCC1(CC2)CO)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)