CAS 79359-58-3 is the registry number for 2,2,8,8-Tetramethyl-3,4,9,10-tetrahydro-2H,8H-pyrano[2,3-f]chromene-6-carbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromene-6-carbaldehyde (CAS 79359-58-3) is a chemical compound with the molecular formula C17H22O3 and a molecular weight of 274.35 g/mol. IUPAC name: 2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromene-6-carbaldehyde. InChIKey: YRHXMLXYKUKULK-UHFFFAOYSA-N.
| Molecular formula | C17H22O3 |
|---|---|
| Molecular weight | 274.35 g/mol |
| IUPAC name | 2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromene-6-carbaldehyde |
| InChIKey | YRHXMLXYKUKULK-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=CC(=C3C(=C2O1)CCC(O3)(C)C)C=O)C |
Computed by PubChem (NCBI)