CAS 113342-33-9 appears in our catalog under these names: 3-(2,4-Dimethylphenyl)-1h-pyrazole-5-carboxylic acid, 95%, 5-(2,4-Dimethylphenyl)-1H-pyrazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
3-(2,4-dimethylphenyl)-1H-pyrazole-5-carboxylic acid (CAS 113342-33-9) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3-(2,4-dimethylphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: XSEUPOAEAAAQGG-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3-(2,4-dimethylphenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | XSEUPOAEAAAQGG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NNC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)