Products 1133881-04-5
CAS 1133881-04-5 is the registry number for Citalopram Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carboxylic acid (CAS 1133881-04-5) is a chemical compound with the molecular formula C20H22FNO3 and a molecular weight of 343.4 g/mol. IUPAC name: (1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carboxylic acid. InChIKey: GECQEQCYCDJXJC-FQEVSTJZSA-N.
| Molecular formula | C20H22FNO3 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carboxylic acid |
| InChIKey | GECQEQCYCDJXJC-FQEVSTJZSA-N |
| SMILES | CN(C)CCC[C@@]1(C2=C(CO1)C=C(C=C2)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)
Synonyms:
Escitalopram Impurity 48