CAS 2575750-19-3 is the registry number for Paroxetine Impurity 3 ((3R, 4S)-N-Methyl Paroxetinej. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-methylpiperidine (CAS 2575750-19-3) is a chemical compound with the molecular formula C20H22FNO3 and a molecular weight of 343.4 g/mol. IUPAC name: (3R,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-methylpiperidine. InChIKey: MOJZPKOBKCXNKG-CRAIPNDOSA-N.
| Molecular formula | C20H22FNO3 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (3R,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-methylpiperidine |
| InChIKey | MOJZPKOBKCXNKG-CRAIPNDOSA-N |
| SMILES | CN1CC[C@@H]([C@H](C1)COC2=CC3=C(C=C2)OCO3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)