CAS 440121-09-5 appears in our catalog under these names: Escitalopram EP Impurity M, Citalopram Impurity 27（Escitalopram EP Impurity M）, Citalopram Carboxylic Acid Impurity, Descyano citalopram carboxylic acid. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carboxylic acid (CAS 440121-09-5) is a chemical compound with the molecular formula C20H22FNO3 and a molecular weight of 343.4 g/mol. IUPAC name: 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carboxylic acid. InChIKey: GECQEQCYCDJXJC-UHFFFAOYSA-N.
| Molecular formula | C20H22FNO3 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carboxylic acid |
| InChIKey | GECQEQCYCDJXJC-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)