Products 1134-00-5
CAS 1134-00-5 appears in our catalog under these names: 5-Chloro-3-methyl-1-benzofuran-2-carboxylic acid, 95%, 5-Chloro-3-methylbenzofuran-2-carboxylic acid 97%, 5-chloro-3-methyl-1-benzofuran-2-carboxylic acid, 97%, 97%, 5-CHLORO-3-METHYLBENZOFURAN-2-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg, 500mg, 2.5g.
5-chloro-3-methyl-1-benzofuran-2-carboxylic acid (CAS 1134-00-5) is a chemical compound with the molecular formula C10H7ClO3 and a molecular weight of 210.61 g/mol. IUPAC name: 5-chloro-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: QEYMIQBZTUQKAC-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO3 |
|---|---|
| Molecular weight | 210.61 g/mol |
| IUPAC name | 5-chloro-3-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | QEYMIQBZTUQKAC-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)