Products 242133-59-1
CAS 242133-59-1 appears in our catalog under these names: 7-Methoxy-1-benzofuran-2-carbonyl chloride, 7-Methoxy-1-benzofuran-2-carbonyl chloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
7-methoxy-1-benzofuran-2-carbonyl chloride (CAS 242133-59-1) is a chemical compound with the molecular formula C10H7ClO3 and a molecular weight of 210.61 g/mol. IUPAC name: 7-methoxy-1-benzofuran-2-carbonyl chloride. InChIKey: CESLGDUYYAIOPZ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO3 |
|---|---|
| Molecular weight | 210.61 g/mol |
| IUPAC name | 7-methoxy-1-benzofuran-2-carbonyl chloride |
| InChIKey | CESLGDUYYAIOPZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1OC(=C2)C(=O)Cl |
Computed by PubChem (NCBI)