Products 66041-33-6
CAS 66041-33-6 is the registry number for 6-Chloro-3-oxo-2,3-dihydro-1h-indene-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-3-oxo-1,2-dihydroindene-1-carboxylic acid (CAS 66041-33-6) is a chemical compound with the molecular formula C10H7ClO3 and a molecular weight of 210.61 g/mol. IUPAC name: 6-chloro-3-oxo-1,2-dihydroindene-1-carboxylic acid. InChIKey: OFZCDQDDHXZCMB-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO3 |
|---|---|
| Molecular weight | 210.61 g/mol |
| IUPAC name | 6-chloro-3-oxo-1,2-dihydroindene-1-carboxylic acid |
| InChIKey | OFZCDQDDHXZCMB-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(C1=O)C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)