Products 113402-33-8
CAS 113402-33-8 is the registry number for 4,4',4''-Methanetriyltribenzoic acid, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4-[bis(4-carboxyphenyl)methyl]benzoic acid (CAS 113402-33-8) is a chemical compound with the molecular formula C22H16O6 and a molecular weight of 376.4 g/mol. IUPAC name: 4-[bis(4-carboxyphenyl)methyl]benzoic acid. InChIKey: DGGCITJUDWMCHY-UHFFFAOYSA-N.
| Molecular formula | C22H16O6 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 4-[bis(4-carboxyphenyl)methyl]benzoic acid |
| InChIKey | DGGCITJUDWMCHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)