Products 2721484-76-8
CAS 2721484-76-8 is the registry number for Anti-inflammatory agent 22. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-5-hydroxyphenyl] benzoate (CAS 2721484-76-8) is a chemical compound with the molecular formula C22H16O6 and a molecular weight of 376.4 g/mol. IUPAC name: [2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-5-hydroxyphenyl] benzoate. InChIKey: SOPVGBOKHBQLRO-UXBLZVDNSA-N.
| Molecular formula | C22H16O6 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | [2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-5-hydroxyphenyl] benzoate |
| InChIKey | SOPVGBOKHBQLRO-UXBLZVDNSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=C(C=CC(=C2)O)C(=O)/C=C/C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)