CAS 1201808-24-3 is the registry number for 7-O-Benzyl Luteolin. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg.
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-phenylmethoxychromen-4-one (CAS 1201808-24-3) is a chemical compound with the molecular formula C22H16O6 and a molecular weight of 376.4 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-phenylmethoxychromen-4-one. InChIKey: NGOIESQGCUSOSC-UHFFFAOYSA-N.
| Molecular formula | C22H16O6 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-phenylmethoxychromen-4-one |
| InChIKey | NGOIESQGCUSOSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC(=C(C=C4)O)O)O |
Computed by PubChem (NCBI)