Products 1201808-24-3

CAS 1201808-24-3 is the registry number for 7-O-Benzyl Luteolin. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

2-(3,4-dihydroxyphenyl)-5-hydroxy-7-phenylmethoxychromen-4-one (CAS 1201808-24-3) is a chemical compound with the molecular formula C22H16O6 and a molecular weight of 376.4 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-phenylmethoxychromen-4-one. InChIKey: NGOIESQGCUSOSC-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16O6
Molecular weight376.4 g/mol
IUPAC name2-(3,4-dihydroxyphenyl)-5-hydroxy-7-phenylmethoxychromen-4-one
InChIKeyNGOIESQGCUSOSC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC(=C(C=C4)O)O)O

Computed by PubChem (NCBI)