CAS 113412-15-0 is the registry number for 4-(1-Hydroxyethyl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(1-hydroxyethyl)benzenesulfonamide (CAS 113412-15-0) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 4-(1-hydroxyethyl)benzenesulfonamide. InChIKey: IMAILDNLESYHOJ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 4-(1-hydroxyethyl)benzenesulfonamide |
| InChIKey | IMAILDNLESYHOJ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)S(=O)(=O)N)O |
Computed by PubChem (NCBI)