CAS 113472-97-2 appears in our catalog under these names: 9-epi-Artemisinin, Artemisinin Impurity B (9-epi Artemisinin), Artemisinin Impurity 4, 9-epi-Artemisinin, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 250mg.
(1R,4S,5R,8S,9S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (CAS 113472-97-2) is a chemical compound with the molecular formula C15H22O5 and a molecular weight of 282.33 g/mol. IUPAC name: (1R,4S,5R,8S,9S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one. InChIKey: BLUAFEHZUWYNDE-DWIPZSBTSA-N.
| Molecular formula | C15H22O5 |
|---|---|
| Molecular weight | 282.33 g/mol |
| IUPAC name | (1R,4S,5R,8S,9S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| InChIKey | BLUAFEHZUWYNDE-DWIPZSBTSA-N |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C(=O)O[C@H]3[C@@]24[C@H]1CC[C@](O3)(OO4)C)C |
Computed by PubChem (NCBI)