CAS 924901-58-6 appears in our catalog under these names: Rupesin E, Rupesin E. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
[(1R,3S,4S,6S,7S,8S)-4-hydroxy-3-methyl-10-methylidene-2,9-dioxatricyclo[4.3.1.03,7]decan-8-yl] 3-methylbutanoate (CAS 924901-58-6) is a chemical compound with the molecular formula C15H22O5 and a molecular weight of 282.33 g/mol. IUPAC name: [(1R,3S,4S,6S,7S,8S)-4-hydroxy-3-methyl-10-methylidene-2,9-dioxatricyclo[4.3.1.03,7]decan-8-yl] 3-methylbutanoate. InChIKey: OUZYCPHXWZYMRK-YEZLWPBFSA-N.
| Molecular formula | C15H22O5 |
|---|---|
| Molecular weight | 282.33 g/mol |
| IUPAC name | [(1R,3S,4S,6S,7S,8S)-4-hydroxy-3-methyl-10-methylidene-2,9-dioxatricyclo[4.3.1.03,7]decan-8-yl] 3-methylbutanoate |
| InChIKey | OUZYCPHXWZYMRK-YEZLWPBFSA-N |
| SMILES | CC(C)CC(=O)O[C@H]1[C@H]2[C@@H]3C[C@@H]([C@]2(O[C@@H](C3=C)O1)C)O |
Computed by PubChem (NCBI)