Products 90510-22-8

CAS 90510-22-8 is the registry number for Hexyl syringate. Offered by: Biosynth. Available pack sizes: 5g, 2g, 10g, 25g.

Structural formula: {0} (CAS {1})

Hexyl 4-hydroxy-3,5-dimethoxybenzoate (CAS 90510-22-8) is a chemical compound with the molecular formula C15H22O5 and a molecular weight of 282.33 g/mol. IUPAC name: hexyl 4-hydroxy-3,5-dimethoxybenzoate. InChIKey: ZLUGESOGDIWBKF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22O5
Molecular weight282.33 g/mol
IUPAC namehexyl 4-hydroxy-3,5-dimethoxybenzoate
InChIKeyZLUGESOGDIWBKF-UHFFFAOYSA-N
SMILESCCCCCCOC(=O)C1=CC(=C(C(=C1)OC)O)OC

Computed by PubChem (NCBI)