CAS 113490-76-9 appears in our catalog under these names: (4R)-4-Benzyloxy-L-Proline methyl ester, 95%, Methyl (2S,4R)–4–(benzyloxy)pyrrolidine–2–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g.
Methyl (2S,4R)-4-phenylmethoxypyrrolidine-2-carboxylate (CAS 113490-76-9) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: methyl (2S,4R)-4-phenylmethoxypyrrolidine-2-carboxylate. InChIKey: GYBYGFMCYASWNS-NEPJUHHUSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | methyl (2S,4R)-4-phenylmethoxypyrrolidine-2-carboxylate |
| InChIKey | GYBYGFMCYASWNS-NEPJUHHUSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)