CAS 1135-12-2 appears in our catalog under these names: 4-Benzylaniline, 4-Benzylaniline, 98% , 4-Benzylaniline 98%, 4-BENZYLANILINE, 98%, 98%, 4-Benzylaniline, 98%. Offered by: TRC, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 500g.
4-benzylaniline (CAS 1135-12-2) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 4-benzylaniline. InChIKey: WDTRNCFZFQIWLM-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 4-benzylaniline |
| InChIKey | WDTRNCFZFQIWLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)