Products 113509-54-9
CAS 113509-54-9 is the registry number for N6-Methyladenosine N1-oxide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(1-hydroxy-6-methyliminopurin-9-yl)oxolane-3,4-diol (CAS 113509-54-9) is a chemical compound with the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(1-hydroxy-6-methyliminopurin-9-yl)oxolane-3,4-diol. InChIKey: WSNFPBJZRWYJBW-IOSLPCCCSA-N.
| Molecular formula | C11H15N5O5 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(1-hydroxy-6-methyliminopurin-9-yl)oxolane-3,4-diol |
| InChIKey | WSNFPBJZRWYJBW-IOSLPCCCSA-N |
| SMILES | CN=C1C2=C(N=CN1O)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)