CAS 1135437-92-1 appears in our catalog under these names: 1-Methyl-5-nitro-1H-pyrrolo(2,3-b)pyridine, 98%, 1–Methyl–5–nitro–1H–pyrrolo(2,3–b)pyridine, 1-Methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine, 98%, 98%, 1-Methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 25g, 5g, 100mg, 10g.
1-methyl-5-nitropyrrolo[2,3-b]pyridine (CAS 1135437-92-1) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 1-methyl-5-nitropyrrolo[2,3-b]pyridine. InChIKey: OIMUASCYJUQGSD-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-methyl-5-nitropyrrolo[2,3-b]pyridine |
| InChIKey | OIMUASCYJUQGSD-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=CC(=CN=C21)[N+](=O)[O-] |
Computed by PubChem (NCBI)