CAS 113559-02-7 is the registry number for N-(4-(Piperidine-4-carbonyl)phenyl)methanesulfonamide hydrochloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(piperidine-4-carbonyl)phenyl]methanesulfonamide;hydrochloride (CAS 113559-02-7) is a chemical compound with the molecular formula C13H19ClN2O3S and a molecular weight of 318.82 g/mol. IUPAC name: N-[4-(piperidine-4-carbonyl)phenyl]methanesulfonamide;hydrochloride. InChIKey: RARCYNDGTVCSOP-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O3S |
|---|---|
| Molecular weight | 318.82 g/mol |
| IUPAC name | N-[4-(piperidine-4-carbonyl)phenyl]methanesulfonamide;hydrochloride |
| InChIKey | RARCYNDGTVCSOP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)C(=O)C2CCNCC2.Cl |
Computed by PubChem (NCBI)