CAS 923694-88-6 is the registry number for 2-Chloro-N-{(4-(diethylsulfamoyl)phenyl)methyl}acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[[4-(diethylsulfamoyl)phenyl]methyl]acetamide (CAS 923694-88-6) is a chemical compound with the molecular formula C13H19ClN2O3S and a molecular weight of 318.82 g/mol. IUPAC name: 2-chloro-N-[[4-(diethylsulfamoyl)phenyl]methyl]acetamide. InChIKey: ONRBIRIPRHONMI-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O3S |
|---|---|
| Molecular weight | 318.82 g/mol |
| IUPAC name | 2-chloro-N-[[4-(diethylsulfamoyl)phenyl]methyl]acetamide |
| InChIKey | ONRBIRIPRHONMI-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)CNC(=O)CCl |
Computed by PubChem (NCBI)