Products 680618-26-2
CAS 680618-26-2 is the registry number for 4-(3,3-Dipropyl-ureido)benzenesulfonyl chloride, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
4-(dipropylcarbamoylamino)benzenesulfonyl chloride (CAS 680618-26-2) is a chemical compound with the molecular formula C13H19ClN2O3S and a molecular weight of 318.82 g/mol. IUPAC name: 4-(dipropylcarbamoylamino)benzenesulfonyl chloride. InChIKey: ZBLMDCHHOSQSGC-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O3S |
|---|---|
| Molecular weight | 318.82 g/mol |
| IUPAC name | 4-(dipropylcarbamoylamino)benzenesulfonyl chloride |
| InChIKey | ZBLMDCHHOSQSGC-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)NC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)