Products 113626-85-0
CAS 113626-85-0 is the registry number for Carboprost Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid (CAS 113626-85-0) is a chemical compound with the molecular formula C21H36O5 and a molecular weight of 368.5 g/mol. IUPAC name: (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid. InChIKey: DLJKPYFALUEJCK-AHJQGUAMSA-N.
| Molecular formula | C21H36O5 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid |
| InChIKey | DLJKPYFALUEJCK-AHJQGUAMSA-N |
| SMILES | CCCCC[C@](C)(/C=C/[C@H]1[C@@H](C[C@@H]([C@@H]1C/C=C/CCCC(=O)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Carboprost Impurity 17