CAS 76498-29-8 appears in our catalog under these names: Carboprost Trometamol EP Impurity A, Carboprost Trometamol EP Impurity A (trans-Carboprost), Carboprost Trometamol Impurity 1(Carboprost Trometamol EP Impurity A) (trans-Carboprost), trans-Carboprost, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
(E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid (CAS 76498-29-8) is a chemical compound with the molecular formula C21H36O5 and a molecular weight of 368.5 g/mol. IUPAC name: (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid. InChIKey: DLJKPYFALUEJCK-MRVZPHNRSA-N.
| Molecular formula | C21H36O5 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid |
| InChIKey | DLJKPYFALUEJCK-MRVZPHNRSA-N |
| SMILES | CCCCC[C@@](C)(/C=C/[C@H]1[C@@H](C[C@@H]([C@@H]1C/C=C/CCCC(=O)O)O)O)O |
Computed by PubChem (NCBI)