CAS 41692-11-9 appears in our catalog under these names: Alprostadil (Prostaglandin E1) Impurity 2, 14-Methyl Prostaglandin E1. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-2-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid (CAS 41692-11-9) is a chemical compound with the molecular formula C21H36O5 and a molecular weight of 368.5 g/mol. IUPAC name: 7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-2-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid. InChIKey: OZMYPGMSQVIWNC-YAITVPFGSA-N.
| Molecular formula | C21H36O5 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | 7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-2-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| InChIKey | OZMYPGMSQVIWNC-YAITVPFGSA-N |
| SMILES | CCCCC[C@@H](/C(=C/[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)O)O)/C)O |
Computed by PubChem (NCBI)