Products 1137-00-4

CAS 1137-00-4 is the registry number for DL-7-Azatryptophan monohydrate, 95%. Offered by: AmBeed. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid (CAS 1137-00-4) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid. InChIKey: SNLOIIPRZGMRAB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11N3O2
Molecular weight205.21 g/mol
IUPAC name2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid
InChIKeySNLOIIPRZGMRAB-UHFFFAOYSA-N
SMILESC1=CC2=C(NC=C2CC(C(=O)O)N)N=C1

Computed by PubChem (NCBI)