CAS 1137-00-4 is the registry number for DL-7-Azatryptophan monohydrate, 95%. Offered by: AmBeed. Available pack sizes: 100mg.
2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid (CAS 1137-00-4) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid. InChIKey: SNLOIIPRZGMRAB-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid |
| InChIKey | SNLOIIPRZGMRAB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC=C2CC(C(=O)O)N)N=C1 |
Computed by PubChem (NCBI)