CAS 7303-50-6 appears in our catalog under these names: 2–Amino–3–{1H–pyrrolo(2,3–b)pyridin–3–yl}propanoic acid, H-DL-7-Aza-Trp-OH 98%, 2-Amino-3-(7H-Pyrrolo[2,3-B]Pyridin-3-Yl)Propanoic Acid, 98%, 98%, 7-Aza-DL-tryptophan, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg, 10g.
2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid (CAS 7303-50-6) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid. InChIKey: SNLOIIPRZGMRAB-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid |
| InChIKey | SNLOIIPRZGMRAB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC=C2CC(C(=O)O)N)N=C1 |
Computed by PubChem (NCBI)