CAS 1137063-15-0 appears in our catalog under these names: 2-(4-Chloropyridin-2-yl)-4,4-dimethyl-4,5-dihydrooxazole, 97%, 97%, 2-(4-Chloropyridin-2-yl)-4,4-dimethyl-4,5-dihydrooxazole, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(4-chloro-2-pyridinyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 1137063-15-0) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 2-(4-chloro-2-pyridinyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: HYGQXJBGEMRERM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 2-(4-chloro-2-pyridinyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | HYGQXJBGEMRERM-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=NC=CC(=C2)Cl)C |
Computed by PubChem (NCBI)