CAS 113715-25-6 is the registry number for 4-Ethoxy-6-methyl-1,3-benzenediamine Hydrochloride. Offered by: TRC. Available pack sizes: 5g.
4-ethoxy-6-methylbenzene-1,3-diamine;dihydrochloride (CAS 113715-25-6) is a chemical compound with the molecular formula C9H16Cl2N2O and a molecular weight of 239.14 g/mol. IUPAC name: 4-ethoxy-6-methylbenzene-1,3-diamine;dihydrochloride. InChIKey: YWJGJCGDAUWAQI-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2O |
|---|---|
| Molecular weight | 239.14 g/mol |
| IUPAC name | 4-ethoxy-6-methylbenzene-1,3-diamine;dihydrochloride |
| InChIKey | YWJGJCGDAUWAQI-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C)N)N.Cl.Cl |
Computed by PubChem (NCBI)