Products 1374669-67-6
CAS 1374669-67-6 appears in our catalog under these names: (S)-3-Amino-3-(4-aminophenyl)propan-1-ol dihydrochloride, 95%, (S)–3–Amino–3–(4–aminophenyl)propan–1–ol dihydrochloride, (S)-3-Amino-3-(4-aminophenyl)propan-1-ol dihydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(3S)-3-amino-3-(4-aminophenyl)propan-1-ol;dihydrochloride (CAS 1374669-67-6) is a chemical compound with the molecular formula C9H16Cl2N2O and a molecular weight of 239.14 g/mol. IUPAC name: (3S)-3-amino-3-(4-aminophenyl)propan-1-ol;dihydrochloride. InChIKey: CEIVJARVHKLYPG-WWPIYYJJSA-N.
| Molecular formula | C9H16Cl2N2O |
|---|---|
| Molecular weight | 239.14 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-aminophenyl)propan-1-ol;dihydrochloride |
| InChIKey | CEIVJARVHKLYPG-WWPIYYJJSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CCO)N)N.Cl.Cl |
Computed by PubChem (NCBI)