Products 1609403-57-7

CAS 1609403-57-7 is the registry number for 1-(3-Aminopropyl)-6-methyl-2(1h)-pyridinone dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(3-aminopropyl)-6-methylpyridin-2-one;dihydrochloride (CAS 1609403-57-7) is a chemical compound with the molecular formula C9H16Cl2N2O and a molecular weight of 239.14 g/mol. IUPAC name: 1-(3-aminopropyl)-6-methylpyridin-2-one;dihydrochloride. InChIKey: VSKRWFTVHAGMNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16Cl2N2O
Molecular weight239.14 g/mol
IUPAC name1-(3-aminopropyl)-6-methylpyridin-2-one;dihydrochloride
InChIKeyVSKRWFTVHAGMNZ-UHFFFAOYSA-N
SMILESCC1=CC=CC(=O)N1CCCN.Cl.Cl

Computed by PubChem (NCBI)