Products 113730-57-7
CAS 113730-57-7 appears in our catalog under these names: Ethyl 7-bromo-2,3-dihydrobenzofuran-2-carboxylate, 95%, Ethyl 7-bromo-2,3-dihydro-benzofuran-2-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
Ethyl 7-bromo-2,3-dihydro-1-benzofuran-2-carboxylate (CAS 113730-57-7) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: ethyl 7-bromo-2,3-dihydro-1-benzofuran-2-carboxylate. InChIKey: WUFMOLTUKPGFMI-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | ethyl 7-bromo-2,3-dihydro-1-benzofuran-2-carboxylate |
| InChIKey | WUFMOLTUKPGFMI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(O1)C(=CC=C2)Br |
Computed by PubChem (NCBI)