Products 113785-82-3

CAS 113785-82-3 is the registry number for 3-Amino-4-cyclohexyl-2-hydroxybutanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-amino-4-cyclohexyl-2-hydroxybutanoic acid;hydrochloride (CAS 113785-82-3) is a chemical compound with the molecular formula C10H20ClNO3 and a molecular weight of 237.72 g/mol. IUPAC name: 3-amino-4-cyclohexyl-2-hydroxybutanoic acid;hydrochloride. InChIKey: NPQZMSTUVAOAFH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO3
Molecular weight237.72 g/mol
IUPAC name3-amino-4-cyclohexyl-2-hydroxybutanoic acid;hydrochloride
InChIKeyNPQZMSTUVAOAFH-UHFFFAOYSA-N
SMILESC1CCC(CC1)CC(C(C(=O)O)O)N.Cl

Computed by PubChem (NCBI)