CAS 2883819-42-7 is the registry number for tert-Butyl ((2R,3R)-4-chloro-3-hydroxy-3-methylbutan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-3-methylbutan-2-yl]carbamate (CAS 2883819-42-7) is a chemical compound with the molecular formula C10H20ClNO3 and a molecular weight of 237.72 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-3-methylbutan-2-yl]carbamate. InChIKey: UFLHHHGGEXRSFE-XCBNKYQSSA-N.
| Molecular formula | C10H20ClNO3 |
|---|---|
| Molecular weight | 237.72 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-3-methylbutan-2-yl]carbamate |
| InChIKey | UFLHHHGGEXRSFE-XCBNKYQSSA-N |
| SMILES | C[C@H]([C@](C)(CCl)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)