Products 2230799-68-3

CAS 2230799-68-3 is the registry number for Methyl 4-(2-methoxyethyl)piperidine-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 4-(2-methoxyethyl)piperidine-4-carboxylate;hydrochloride (CAS 2230799-68-3) is a chemical compound with the molecular formula C10H20ClNO3 and a molecular weight of 237.72 g/mol. IUPAC name: methyl 4-(2-methoxyethyl)piperidine-4-carboxylate;hydrochloride. InChIKey: YIPZQYCAGCRHIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO3
Molecular weight237.72 g/mol
IUPAC namemethyl 4-(2-methoxyethyl)piperidine-4-carboxylate;hydrochloride
InChIKeyYIPZQYCAGCRHIQ-UHFFFAOYSA-N
SMILESCOCCC1(CCNCC1)C(=O)OC.Cl

Computed by PubChem (NCBI)