CAS 1138-41-6 appears in our catalog under these names: 4-Hydroxy-3-prenylbenzoic Acid, 4-Hydroxy-3-(3-methylbut-2-en-1-yl)benzoic acid, 4-Hydroxy-3-(3-methylbut-2-en-1-yl)benzoic acid 95%, 4-Hydroxy-3-prenylbenzoic Acid, 95%, 95%, 4-Hydroxy-3-prenylbenzoic Acid, 95%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 50mg.
3-dimethylallyl-4-hydroxybenzoic acid is a monohydroxybenzoic acid that is 4-hydroxybenzoic acid bearing an additional dimethylallyl substituent at position 3. It has a role as a plant metabolite. It is a conjugate acid of a 3-dimethylallyl-4-hydroxybenzoate.
Source: ChEBI
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 4-hydroxy-3-(3-methylbut-2-enyl)benzoic acid |
| InChIKey | LBSJJNAMGVDGCU-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)C(=O)O)O)C |
Computed by PubChem (NCBI)