CAS 1138-53-0 appears in our catalog under these names: 1-N-Methylbenzene-1,4-disulfonamide, 95%, 1-N-Methylbenzene-1,4-disulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-N-methylbenzene-1,4-disulfonamide (CAS 1138-53-0) is a chemical compound with the molecular formula C7H10N2O4S2 and a molecular weight of 250.3 g/mol. IUPAC name: 4-N-methylbenzene-1,4-disulfonamide. InChIKey: QWMGQMVXUZNDTO-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 4-N-methylbenzene-1,4-disulfonamide |
| InChIKey | QWMGQMVXUZNDTO-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)