CAS 1138077-59-4 is the registry number for 2-(1-(3-Chlorophenyl)ethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: TRC. Available pack sizes: 500mg.
2-[1-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1138077-59-4) is a chemical compound with the molecular formula C14H20BClO2 and a molecular weight of 266.57 g/mol. IUPAC name: 2-[1-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DLXPGTXKLIDKLJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BClO2 |
|---|---|
| Molecular weight | 266.57 g/mol |
| IUPAC name | 2-[1-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DLXPGTXKLIDKLJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)