CAS 1315277-53-2 appears in our catalog under these names: 2-(3-Chlorophenyl)ethylboronic acid pinacol ester, 97%, 2-(3-Chlorophenethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 2-(3-Chlorophenyl)ethylboronic acid pinacol ester, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g, 250mg.
2-[2-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1315277-53-2) is a chemical compound with the molecular formula C14H20BClO2 and a molecular weight of 266.57 g/mol. IUPAC name: 2-[2-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WZAJMSPJXKZSTL-UHFFFAOYSA-N.
| Molecular formula | C14H20BClO2 |
|---|---|
| Molecular weight | 266.57 g/mol |
| IUPAC name | 2-[2-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WZAJMSPJXKZSTL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)