CAS 2121514-19-8 appears in our catalog under these names: 4-Chloro-2,3-dimethylphenylboronic acid pinacol ester, 95%, 4-Chloro-2,3-dimethylphenylboronic acid pinacol ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2-(4-chloro-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-19-8) is a chemical compound with the molecular formula C14H20BClO2 and a molecular weight of 266.57 g/mol. IUPAC name: 2-(4-chloro-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DFVMKWDRRRRQQQ-UHFFFAOYSA-N.
| Molecular formula | C14H20BClO2 |
|---|---|
| Molecular weight | 266.57 g/mol |
| IUPAC name | 2-(4-chloro-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DFVMKWDRRRRQQQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)Cl)C)C |
Computed by PubChem (NCBI)