Products 113808-88-1
CAS 113808-88-1 appears in our catalog under these names: 1-(4-Bromophenyl)-3,5-dimethyl-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Bromophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 250mg, 10g, 1g.
1-(4-bromophenyl)-3,5-dimethylpyrazole-4-carboxylic acid (CAS 113808-88-1) is a chemical compound with the molecular formula C12H11BrN2O2 and a molecular weight of 295.13 g/mol. IUPAC name: 1-(4-bromophenyl)-3,5-dimethylpyrazole-4-carboxylic acid. InChIKey: PIBOZBTXIGCQQJ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O2 |
|---|---|
| Molecular weight | 295.13 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3,5-dimethylpyrazole-4-carboxylic acid |
| InChIKey | PIBOZBTXIGCQQJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)Br)C)C(=O)O |
Computed by PubChem (NCBI)