CAS 2504202-15-5 is the registry number for 4-(4-Bromo-imidazol-1-ylmethyl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-[(4-bromoimidazol-1-yl)methyl]benzoate (CAS 2504202-15-5) is a chemical compound with the molecular formula C12H11BrN2O2 and a molecular weight of 295.13 g/mol. IUPAC name: methyl 4-[(4-bromoimidazol-1-yl)methyl]benzoate. InChIKey: FZPLRKXILCVUGI-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O2 |
|---|---|
| Molecular weight | 295.13 g/mol |
| IUPAC name | methyl 4-[(4-bromoimidazol-1-yl)methyl]benzoate |
| InChIKey | FZPLRKXILCVUGI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CN2C=C(N=C2)Br |
Computed by PubChem (NCBI)