CAS 98534-71-5 appears in our catalog under these names: 5-Bromo-1-phenyl-1h-pyrazole-4-carboxylic acid ethyl ester, 95%, Ethyl 5–bromo–1–phenyl–1H–pyrazole–4–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 5-bromo-1-phenylpyrazole-4-carboxylate (CAS 98534-71-5) is a chemical compound with the molecular formula C12H11BrN2O2 and a molecular weight of 295.13 g/mol. IUPAC name: ethyl 5-bromo-1-phenylpyrazole-4-carboxylate. InChIKey: JLHHULMEYIHSNI-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O2 |
|---|---|
| Molecular weight | 295.13 g/mol |
| IUPAC name | ethyl 5-bromo-1-phenylpyrazole-4-carboxylate |
| InChIKey | JLHHULMEYIHSNI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)