Products 1138150-98-7

CAS 1138150-98-7 is the registry number for 5-Benzyl 1-tert-butyl 1,2,5-triazepane-1,5-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-O-benzyl 1-O-tert-butyl 1,2,5-triazepane-1,5-dicarboxylate (CAS 1138150-98-7) is a chemical compound with the molecular formula C17H25N3O4 and a molecular weight of 335.4 g/mol. IUPAC name: 5-O-benzyl 1-O-tert-butyl 1,2,5-triazepane-1,5-dicarboxylate. InChIKey: KVJUCQBYIRWJBO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25N3O4
Molecular weight335.4 g/mol
IUPAC name5-O-benzyl 1-O-tert-butyl 1,2,5-triazepane-1,5-dicarboxylate
InChIKeyKVJUCQBYIRWJBO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CCN1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)