CAS 1138445-20-1 is the registry number for 4-(1,1-Difluoroethyl)-1-fluoro-2-(trifluoromethyl)benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(1,1-difluoroethyl)-1-fluoro-2-(trifluoromethyl)benzene (CAS 1138445-20-1) is a chemical compound with the molecular formula C9H6F6 and a molecular weight of 228.13 g/mol. IUPAC name: 4-(1,1-difluoroethyl)-1-fluoro-2-(trifluoromethyl)benzene. InChIKey: XJEPHGWSBZJRIX-UHFFFAOYSA-N.
| Molecular formula | C9H6F6 |
|---|---|
| Molecular weight | 228.13 g/mol |
| IUPAC name | 4-(1,1-difluoroethyl)-1-fluoro-2-(trifluoromethyl)benzene |
| InChIKey | XJEPHGWSBZJRIX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)F)C(F)(F)F)(F)F |
Computed by PubChem (NCBI)